CAS 502496-32-4

2-Amino-6-bromo-4-fluorophenol

Description:

2-Amino-6-bromo-4-fluorophenol is an organic compound characterized by the presence of an amino group (-NH2), a bromine atom, and a fluorine atom attached to a phenolic ring. This compound features a phenol structure, which contributes to its potential as a weak acid due to the hydroxyl (-OH) group. The amino group provides basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The presence of bromine and fluorine introduces significant electronegativity differences, influencing the compound's reactivity and polarity. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its unique combination of functional groups can lead to diverse applications in organic synthesis, particularly in the development of dyes, agrochemicals, or pharmaceuticals. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-Amino-6-bromo-4-fluorophenol is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₆H₅BrFNO

InChI: InChI=1S/C6H5BrFNO/c7-4-1-3(8)2-5(9)6(4)10/h1-2,10H,9H2

InChI key: InChIKey=YPSXHYMXEAXEAD-UHFFFAOYSA-N

SMILES: OC1=C(Br)C=C(F)C=C1N

Synonyms:

• Phenol, 2-amino-6-bromo-4-fluoro-
• 2-Amino-6-bromo-4-fluorophenol

2-Amino-6-bromo-4-fluorophenol

CAS: 502496-32-4

Formula: C₆H₅BrFNO

Purity: 95%

Molecular weight: 206.0124

Ref: IN-DA00DKKL

2-Amino-6-bromo-4-fluorophenol

CAS: 502496-32-4

2-Amino-6-bromo-4-fluorophenol

Formula: C₆H₅BrFNO

Purity: 95%

Color and Shape: reddish brown crystalline powder

Molecular weight: 206.01g/mol

Ref: 54-PC2774

2-Amino-6-bromo-4-fluorophenol

CAS: 502496-32-4

2-Amino-6-bromo-4-fluorophenol is a reagent that is used in the synthesis of complex compounds. It is also a useful intermediate for the production of fine chemicals and speciality chemicals. This chemical is used as a building block in the synthesis of versatile building blocks, which are needed to produce speciality chemicals such as pharmaceuticals, agrochemicals, fragrances, and dyes. 2-Amino-6-bromo-4-fluorophenol has been used as a reaction component in the synthesis of various organic compounds. It can be synthesized from phenol or aniline via reductive amination.

Formula: C₆H₅BrFNO

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 206.01 g/mol

Ref: 3D-CVA49632