CAS 502496-33-5

1-Bromo-5-fluoro-2-methyl-3-nitrobenzene

Description:

1-Bromo-5-fluoro-2-methyl-3-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, a methyl group, and a nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the meta position relative to the methyl group (-CH3) and halogen substituents at the para positions, which influence the compound's reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique combination of functional groups can impart specific chemical reactivity, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. The presence of both bromine and fluorine atoms can enhance the compound's electrophilic character, while the nitro group can serve as a strong electron-withdrawing group, affecting the overall electron density on the aromatic ring. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.

Formula: C₇H₅BrFNO₂

InChI: InChI=1S/C7H5BrFNO2/c1-4-6(8)2-5(9)3-7(4)10(11)12/h2-3H,1H3

InChI key: InChIKey=ZVDFTBJXUXQPAU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C)C(Br)=CC(F)=C1

Synonyms:

• 2-Bromo-4-Fluoro-6-Nitrotoluene
• Benzene, 1-Bromo-5-Fluoro-2-Methyl-3-Nitro-
• 1-Bromo-5-fluoro-2-methyl-3-nitrobenzene

2-Bromo-4-fluoro-6-nitrotoluene

CAS: 502496-33-5

Formula: C₇H₅BrFNO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 234.0225

Ref: IN-DA00335B

2-Bromo-4-fluoro-6-nitrotoluene

CAS: 502496-33-5

2-Bromo-4-fluoro-6-nitrotoluene

Formula: C₇H₅BrFNO₂

Purity: 97%

Color and Shape: light yellow fused solid

Molecular weight: 234.02g/mol

Ref: 54-PC2783

2-Bromo-4-fluoro-6-nitrotoluene

CAS: 502496-33-5

Formula: C₇H₅BrFNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.024

Ref: 10-F050534