CAS 5025-82-1
:N-Acetyl-4-thiazolidinecarboxylic acid
Description:
N-Acetyl-4-thiazolidinecarboxylic acid, with the CAS number 5025-82-1, is a chemical compound characterized by its thiazolidine ring structure, which incorporates a thiazole moiety and an acetyl group. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, making it versatile for different applications. It possesses functional groups that contribute to its reactivity, including a carboxylic acid and an amide, which can participate in various chemical reactions such as esterification and amidation. N-Acetyl-4-thiazolidinecarboxylic acid is of interest in medicinal chemistry and biochemistry, particularly for its potential biological activities, including antioxidant properties and its role in metabolic pathways. Additionally, it may serve as a precursor in the synthesis of other thiazolidine derivatives, which are explored for their pharmacological properties. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.
Formula:C6H9NO3S
InChI:InChI=1S/C6H9NO3S/c1-4(8)7-3-11-2-5(7)6(9)10/h5H,2-3H2,1H3,(H,9,10)
InChI key:InChIKey=WXTBYSIPOKXCPM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1N(C(C)=O)CSC1
Synonyms:- 3-Acetyl-1,3-Thiazolidine-4-Carboxylic Acid
- 3-Acetyl-4-thiazolidinecarboxylic Acid
- 4-Thiazolidinecarboxylic acid, 3-acetyl-
- Aminofol
- Fantac
- Fantac Plus
- Folcisteine
- N-Acetyl-1,3-thiazolidine-4-carboxylic acid
- N-Acetyl-4-thiazolidinecarboxylic acid
- NSC 146111
- ATCA
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3-Acetylthiazolidine-4-Carboxylic Acid
CAS:Formula:C6H9NO3SPurity:98%Color and Shape:SolidMolecular weight:175.20563-Acetylthiazolidine-4-Carboxylic Acid
CAS:3-Acetylthiazolidine-4-Carboxylic AcidPurity:98%Molecular weight:175.21g/molN-Acetylthiazolidine-4-carboxylic acid
CAS:Formula:C6H9NO3SColor and Shape:NeatMolecular weight:175.21Folcisteine
CAS:Folcisteine (3-Acetylthiazolidine-4-carboxylic acid) is a kind of plant growth regulator.Formula:C6H9NO3SPurity:97.39%Color and Shape:White Crystalline PowderMolecular weight:175.206Folcisteine (ATCA, NATCA) pure, 99%
CAS:Formula:C6H9NO3SPurity:min. 99%Color and Shape:White to off - white, PowderMolecular weight:175.03N-Acetyl-thiazolidine 4-carboxylic acid
CAS:N-Acetyl-thiazolidine 4-carboxylic acid is a natural product that has been shown to have an acetylation activity. Acetylation of N-Acetyl-thiazolidine 4-carboxylic acid is achieved by reacting it with acetic anhydride in the presence of a base, such as triethylamine. This reaction produces N-acetyl-thiazolidine 4,5 dicarboxylic acid. Acetylation of the compound prevents it from being oxidized, which may prevent the formation of toxic substances. It is also used as a diluent for other medicines and drugs. The acetylated form is sold under the trade name "Thiazone".Formula:C6H9NO3SPurity:Min. 95%Color and Shape:PowderMolecular weight:175.21 g/mol








