CAS 502546-41-0: 5-cyclopropyl-1H-1,2,4-triazol-3-amine

Description:5-Cyclopropyl-1H-1,2,4-triazol-3-amine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of a cyclopropyl group enhances its structural complexity and may influence its biological activity. This compound is typically studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of various bioactive molecules. The amine functional group contributes to its reactivity and solubility properties, making it a versatile intermediate in organic synthesis. Additionally, the triazole moiety is known for its ability to form hydrogen bonds, which can enhance interactions with biological targets. The compound's CAS number, 502546-41-0, serves as a unique identifier in chemical databases, facilitating its identification and research. Overall, 5-cyclopropyl-1H-1,2,4-triazol-3-amine is of interest in medicinal chemistry due to its potential therapeutic applications and unique structural features.

Formula:C₅H₈N₄

InChI:InChI=1/C5H8N4/c6-5-7-4(8-9-5)3-1-2-3/h3H,1-2H2,(H3,6,7,8,9)

Synonyms:
4H-1,2,4-Triazol-3-amine, 5-cyclopropyl-
5-Cyclopropyl-4H-1,2,4-triazol-3-amine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-Cyclopropyl-1,2,4-triazol-3-ylamine REF: IN-DA00D84VCAS: 502546-41-0	95%	To inquire	Tue 15 Apr 25
5-Cyclopropyl-4H-1,2,4-triazol-3-amine REF: 54-OR98053CAS: 502546-41-0	95%	52.00 €~1,919.00 €	Wed 16 Apr 25
5-Cyclopropyl-1,2,4-triazol-3-ylamine REF: 10-F021274CAS: 502546-41-0	98.0%	50.00 €~975.00 €	Mon 21 Apr 25
5-Cyclopropyl-1H-1,2,4-triazol-3-amine REF: 3D-CVA54641CAS: 502546-41-0	Min. 95%	- - -	Discontinued product