CAS 502649-32-3

1-Boc-3-isopropylpiperazine

Description:

1-Boc-3-isopropylpiperazine, with the CAS number 502649-32-3, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in organic synthesis, particularly in the context of amines, which in this case is attached to the nitrogen atom of the piperazine. The isopropyl group contributes to the compound's hydrophobic characteristics and steric bulk, influencing its reactivity and solubility. This compound is typically utilized in medicinal chemistry and drug development, often serving as an intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 1-Boc-3-isopropylpiperazine is significant in the field of organic synthesis and pharmaceutical research due to its structural features and functional versatility.

Formula: C₁₂H₂₄N₂O₂

InChI: InChI=1/C12H24N2O2/c1-9(2)10-8-14(7-6-13-10)11(15)16-12(3,4)5/h9-10,13H,6-8H2,1-5H3

SMILES: CC(C)C1CN(CCN1)C(=O)OC(C)(C)C

Synonyms:

• 1-Boc-3-isopropyl-piperazine
• Tert-Butyl 3-Isopropylpiperazine-1-Carboxylate

1-Boc-3-Isopropylpiperazine

CAS: 502649-32-3

Formula: C₁₂H₂₄N₂O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 228.3312

Ref: IN-DA0032OU

1-Boc-3-isopropyl-piperazine

CAS: 502649-32-3

1-Boc-3-isopropyl-piperazine

Purity: 98%

Molecular weight: 228.33g/mol

Ref: 54-OR1001849

1-Boc-3-Isopropylpiperazine

CAS: 502649-32-3

Formula: C₁₂H₂₄N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.336

Ref: 10-F233211