CAS 502651-28-7

7-oxo-7-[3-(trifluoromethyl)phenyl]heptanoic acid

Description:

7-Oxo-7-[3-(trifluoromethyl)phenyl]heptanoic acid is a synthetic organic compound characterized by its unique structure, which includes a heptanoic acid backbone with a ketone functional group and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both carboxylic acids and ketones, such as acidity and potential reactivity in various chemical reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, while the ketone could engage in various reactions, including nucleophilic additions. Additionally, the trifluoromethyl group can significantly affect the electronic properties of the molecule, potentially altering its reactivity and interaction with biological targets. Overall, 7-oxo-7-[3-(trifluoromethyl)phenyl]heptanoic acid is a compound of interest in medicinal chemistry and material science due to its distinctive functional groups and potential applications.

Formula: C₁₄H₁₅F₃O₃

InChI: InChI=1/C14H15F3O3/c15-14(16,17)11-6-4-5-10(9-11)12(18)7-2-1-3-8-13(19)20/h4-6,9H,1-3,7-8H2,(H,19,20)

SMILES: C(CCC(=O)c1cccc(c1)C(F)(F)F)CCC(=O)O

7-oxo-7-(3-trifluoromethylphenyl)heptanoic acid

CAS: 502651-28-7

Formula: C₁₄H₁₅F₃O₃

Purity: 97.0%

Molecular weight: 288.266

Ref: 10-F207336