CAS 502651-38-9

6-oxo-6-[4-(trifluoromethyl)phenyl]hexanoic acid

Description:

6-Oxo-6-[4-(trifluoromethyl)phenyl]hexanoic acid, with the CAS number 502651-38-9, is a synthetic organic compound characterized by its unique structure that includes a hexanoic acid backbone and a trifluoromethyl-substituted phenyl group. This compound features a ketone functional group (6-oxo) and is classified as a carboxylic acid due to the presence of the carboxyl (-COOH) group. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The presence of the ketone and carboxylic acid functionalities suggests potential reactivity in various organic reactions, including esterification and condensation. Additionally, the compound's fluorinated aromatic ring may impart unique electronic properties, affecting its interaction with biological targets. Overall, 6-oxo-6-[4-(trifluoromethyl)phenyl]hexanoic acid is notable for its structural complexity and potential applications in medicinal chemistry and material science.

Formula: C₁₃H₁₃F₃O₃

InChI: InChI=1/C13H13F3O3/c14-13(15,16)10-7-5-9(6-8-10)11(17)3-1-2-4-12(18)19/h5-8H,1-4H2,(H,18,19)

SMILES: C(CCC(=O)O)CC(=O)c1ccc(cc1)C(F)(F)F

6-Oxo-6-(4-trifluoromethylphenyl)hexanoic acid

CAS: 502651-38-9

Formula: C₁₃H₁₃F₃O₃

Purity: 97.0%

Molecular weight: 274.239

Ref: 10-F207340