CAS 50269-95-9

1H-pyrrole-2-carbohydrazide

Description:

1H-pyrrole-2-carbohydrazide, with the CAS number 50269-95-9, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a hydrazide functional group, which contributes to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of hydrophilic functional groups. The compound is of interest in medicinal chemistry and materials science, as it may possess biological activity and can be utilized in the synthesis of more complex molecules. Its reactivity can be attributed to the presence of both the hydrazide and pyrrole functionalities, allowing for potential interactions with various electrophiles and nucleophiles. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1H-pyrrole-2-carbohydrazide represents a versatile building block in organic synthesis.

Formula: C₅H₇N₃O

InChI: InChI=1/C5H7N3O/c6-8-5(9)4-2-1-3-7-4/h1-3,7H,6H2,(H,8,9)

SMILES: c1cc(C(=O)NN)[nH]c1

1H-Pyrrole-2-carbohydrazide

CAS: 50269-95-9

Formula: C₅H₇N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.1286

Ref: IN-DA00D9RW

1H-Pyrrole-2-carbohydrazide

CAS: 50269-95-9

1H-Pyrrole-2-carbohydrazide

Purity: 95

Color and Shape: Solid

Molecular weight: 125.13g/mol

Ref: 54-OR27344

1H-Pyrrole-2-carboxylic acid hydrazide

CAS: 50269-95-9

Formula: C₅H₇N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.131

Ref: 10-F020752

1H-pyrrole-2-carbohydrazide

CAS: 50269-95-9

1H-Pyrrole-2-carbohydrazide is an antimicrobial agent that belongs to the group of synthetic compounds. It can be synthesized by the cross-coupling reaction of anilines with halides, diastereomeric products being formed. The reaction product is purified by preparative high performance liquid chromatography (prep HPLC) and tested for antimycobacterial activity in vitro. 1H-pyrrole-2-carbohydrazide has been shown to inhibit the growth of Mycobacterium tuberculosis and Mycobacterium avium complex at a concentration of 10 μM. This compound also inhibits the synthesis of proteins and nucleic acids, which are essential for bacterial growth.

Formula: C₅H₇N₃O

Purity: Min. 95%

Molecular weight: 125.13 g/mol

Ref: 3D-ACA26995