CAS 5027-65-6
:5-(methoxycarbonyl)pyridine-3-carboxylic acid
Description:
5-(Methoxycarbonyl)pyridine-3-carboxylic acid, with the CAS number 5027-65-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two functional groups: a methoxycarbonyl group (-COOCH3) and a carboxylic acid group (-COOH), both of which contribute to its chemical reactivity and solubility properties. The presence of these groups makes it a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. The compound can participate in various chemical reactions, including esterification and amidation, making it valuable in synthetic chemistry. Additionally, its structural features may influence its biological activity, making it of interest in medicinal chemistry research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H7NO4
InChI:InChI=1/C8H7NO4/c1-13-8(12)6-2-5(7(10)11)3-9-4-6/h2-4H,1H3,(H,10,11)
SMILES:COC(=O)c1cc(cnc1)C(=O)O
Synonyms:- 3,5-Pyridinecarboxylic acid, 3-methyl ester
- 3,5-Pyridinedicarboxylic Acid, Monomethyl Ester
- 5-(Methoxycarbonyl)nicotinic acid
- 3,5-Pyridinedicarboxylic Acid, 3-methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-(METHOXYCARBONYL)NICOTINIC ACID
CAS:Formula:C8H7NO4Purity:95%Color and Shape:SolidMolecular weight:181.1475-(Methoxycarbonyl);nicotinic acid
CAS:Formula:C8H7NO4Purity:95%Color and Shape:SolidMolecular weight:181.14555-(Methoxycarbonyl)nicotinic acid
CAS:5-(Methoxycarbonyl)nicotinic acidPurity:95%Molecular weight:181.15g/mol5-(methoxycarbonyl)pyridine-3-carboxylic acid
CAS:<p>5-(Methoxycarbonyl)pyridine-3-carboxylic acid is a methyl ester that belongs to the group of acid halides. It is used industrially as a precursor to other compounds. The crystals are anhydrous and appear in colorless plates or needles, with a melting point of 102-104°C. The compound can be prepared by reacting hydrogen chloride with dimethyl 5-(methoxycarbonyl)pyridine-3-carboxylate, which has been obtained from methyl acetoacetate and methylamine hydrochloride. 5-(Methoxycarbonyl)pyridine-3-carboxylic acid has been shown to have antihypertensive properties and is used for the treatment of hypertension in combination with lercanidipine.</p>Formula:C8H7NO4Purity:Min. 95%Molecular weight:181.1 g/mol



