
CAS 5027-82-7
:3,4-Pyridinedimethan-α3,α3-d2-ol, 5-hydroxy-6-methyl-, hydrochloride
Description:
3,4-Pyridinedimethan-α3,α3-d2-ol, 5-hydroxy-6-methyl-, hydrochloride, with the CAS number 5027-82-7, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with hydroxyl and methyl groups, contributing to its unique chemical properties. The presence of deuterium (α3,α3-d2) indicates that certain hydrogen atoms in the molecule are replaced with deuterium, which can affect its physical and chemical behavior, including isotopic labeling in research applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical and pharmaceutical applications. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its characteristics, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other substances. Proper handling and storage are essential due to potential health hazards associated with chemical compounds.
Formula:C8H9D2NO3·ClH
InChI:InChI=1S/C8H11NO3.ClH/c1-5-8(12)7(4-11)6(3-10)2-9-5;/h2,10-12H,3-4H2,1H3;1H/i3D2;
InChI key:InChIKey=ZUFQODAHGAHPFQ-BCKZTNHCSA-N
SMILES:C(O)C=1C(C(O)([2H])[2H])=CN=C(C)C1O.Cl
Synonyms:- Pyridoxol-α3,α3-d2, hydrochloride
- 3,4-Pyridinedimethan-α3,α3-d2-ol, 5-hydroxy-6-methyl-, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pyridoxine-d2 HCl (5-hydroxy-methyl-d2)
CAS:Purity:98 atom % DColor and Shape:White SolidMolecular weight:207.65Pyridoxine-d2 Hydrochloride
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications Pyridoxine-d2 Hydrochloride is a labelled analogue of Pyridoxine Hydrochloride (P991735), one of the vitamins of the B6 complex; present in many foodstuffs (yeast, liver and cereals). Pyridoxine has a role in transporting protein Bsu1, Pyridoxine contributes to thiamine uptake; characterization of thiamine (vitamin B1) transporter Thi9 from Schizosaccharomyces pombe.<br>References Williams, R., et al.: J. Biol. Chem., 87, 581 (1930); Rodionov, D., et al.: J. Biol. Chem., 277, 48949 (2002),; Nosaka, K., et al.: Mol. Microbiol., 58, 467 (2005);<br></p>Formula:C82H2H9NO3·ClHColor and Shape:NeatMolecular weight:207.65Pyridoxine-d2 HCl
CAS:Pyridoxine-d2 HCl is a deuterated compound of Pyridoxine HCl. Pyridoxine HCl has a CAS number of 58-56-0. Pyridoxine hydrochloride is the 4-methanol form of vitaminB6 which is converted to pyridoxal phosphate which is a coenzyme for synthesis of amino acids, neurotransmitters (serotonin, norepinephrine), sphingolipids, aminolevulinic acid.Formula:C8H10D2ClNO3Color and Shape:SolidMolecular weight:207.65


