
CAS 50270-33-2
:Isofezolac
Description:
Isofezolac, identified by its CAS number 50270-33-2, is a chemical compound that belongs to the class of non-steroidal anti-inflammatory drugs (NSAIDs). It is primarily characterized by its analgesic and anti-inflammatory properties, making it useful in the treatment of pain and inflammation. The compound exhibits a mechanism of action that typically involves the inhibition of cyclooxygenase enzymes, which play a crucial role in the biosynthesis of prostaglandins, mediators of inflammation and pain. Isofezolac is often evaluated for its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, which influence its efficacy and safety profile. Additionally, like many NSAIDs, it may have side effects, including gastrointestinal disturbances and potential cardiovascular risks, which necessitate careful consideration in clinical use. Its chemical structure and specific functional groups contribute to its biological activity and therapeutic applications. As with any pharmaceutical agent, ongoing research and clinical studies are essential to fully understand its benefits and limitations in medical practice.
Formula:C23H18N2O2
InChI:InChI=1S/C23H18N2O2/c26-21(27)16-20-22(17-10-4-1-5-11-17)23(18-12-6-2-7-13-18)24-25(20)19-14-8-3-9-15-19/h1-15H,16H2,(H,26,27)
InChI key:InChIKey=LZRDDINFIHUVCX-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(C(=NN1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- LM 22102
- 1H-Pyrazole-5-acetic acid, 1,3,4-triphenyl-
- 1,3,4-Triphenyl-1H-pyrazole-5-acetic acid
- Isofezolac
- 1,3,4-Triphenylpyrazole-5-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Isofezolac
CAS:Isofezolac (LM 22070), a NSAID, inhibits prostaglandin-synthetase, offering powerful anti-inflammatory and antipyretic effects.Formula:C23H18N2O2Color and Shape:SolidMolecular weight:354.4
