CymitQuimica logo

CAS 50270-99-0

:

6-Chloro-6-deoxy-β-D-fructofuranosyl α-D-glucopyranoside

Description:
6-Chloro-6-deoxy-β-D-fructofuranosyl α-D-glucopyranoside is a glycoside compound characterized by its structural components derived from fructose and glucose. The presence of a chlorine atom at the 6-position of the fructofuranosyl moiety distinguishes it from other glycosides, potentially influencing its reactivity and biological activity. This compound is typically a white to off-white solid, soluble in water due to its polar hydroxyl groups, which facilitate hydrogen bonding. Its molecular structure suggests it may participate in various biochemical interactions, making it of interest in research related to carbohydrate chemistry and potential applications in pharmaceuticals or biochemistry. The glycosidic bond between the fructofuranosyl and glucopyranosyl units indicates that it may exhibit properties typical of sugars, such as sweetness or involvement in metabolic pathways. However, specific biological activities and applications would require further investigation through empirical studies. As with many chlorinated compounds, safety and handling precautions should be observed due to potential toxicity.
Formula:C12H21ClO10
InChI:InChI=1S/C12H21ClO10/c13-1-4-7(17)10(20)12(3-15,22-4)23-11-9(19)8(18)6(16)5(2-14)21-11/h4-11,14-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1
InChI key:InChIKey=NDAQZBMVJWZZNG-UGDNZRGBSA-N
SMILES:O([C@]1(CO)O[C@H](CCl)[C@@H](O)[C@@H]1O)[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:
  • α-D-Glucopyranoside, 6-chloro-6-deoxy-β-D-fructofuranosyl
  • 6-Chloro-6-deoxy-β-D-fructofuranosyl α-D-glucopyranoside
  • 6′-Chloro-6′-deoxysucrose
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.