CymitQuimica logo

CAS 502762-95-0

:

3,4-difluoro-2-hydroxy-benzaldehyde

Description:
3,4-Difluoro-2-hydroxy-benzaldehyde is an organic compound characterized by the presence of both fluorine and hydroxyl functional groups on a benzaldehyde structure. The compound features a benzene ring substituted with two fluorine atoms at the 3 and 4 positions and a hydroxyl group at the 2 position, along with an aldehyde functional group. This arrangement contributes to its unique chemical properties, including its potential reactivity and solubility in various solvents. The presence of fluorine atoms typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and material science. The hydroxyl group can participate in hydrogen bonding, affecting the compound's physical properties such as boiling and melting points. Additionally, the aldehyde group is reactive, allowing for further chemical modifications. Overall, 3,4-difluoro-2-hydroxy-benzaldehyde is a versatile compound with applications in research and industry, particularly in the synthesis of more complex organic molecules.
Formula:C7H4F2O2
InChI:InChI=1/C7H4F2O2/c8-5-2-1-4(3-10)7(11)6(5)9/h1-3,11H
InChI key:ZIDMZOAQFCFSHA-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1C=O)O)F)F
Synonyms:
  • 3,4-Difluoro-2-hydroxybenzaldehyde
  • Benzaldehyde, 3,4-difluoro-2-hydroxy-
  • 3,4-difluorosalicyladehyde
  • Benzaldehyde, 3,4-difluoro-2-hydroxy- (9CI)
Found 4 products.