CymitQuimica logo

CAS 50277-02-6

:

7-(3,5-dihydroxyphenyl)-5-hydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one

Description:
The chemical substance known as 7-(3,5-dihydroxyphenyl)-5-hydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one, with the CAS number 50277-02-6, is a flavonoid derivative characterized by its complex polyphenolic structure. This compound features a pyranochromone backbone, which is typical of many flavonoids, and is distinguished by the presence of multiple hydroxyl groups that contribute to its potential antioxidant properties. The dihydroxyphenyl group enhances its reactivity and biological activity, making it of interest in various fields, including pharmacology and natural product chemistry. Its structural features suggest that it may exhibit various biological activities, such as anti-inflammatory, antimicrobial, or anticancer effects, although specific studies would be necessary to confirm these properties. Additionally, the presence of multiple hydroxyl groups typically increases solubility in polar solvents, which can influence its bioavailability and interaction with biological systems. Overall, this compound represents a fascinating area of study within the realm of natural products and their potential therapeutic applications.
Formula:C20H16O6
InChI:InChI=1/C20H16O6/c1-20(2)4-3-13-15(26-20)8-16-17(18(13)23)19(24)14(9-25-16)10-5-11(21)7-12(22)6-10/h3-9,21-23H,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Parvisoflavone B

    CAS:
    <p>Parvisoflavone B is a useful organic compound for research related to life sciences. The catalog number is T124761 and the CAS number is 50277-02-6.</p>
    Formula:C20H16O6
    Color and Shape:Solid
    Molecular weight:352.342