CAS 50289-05-9
:4-Amino-4-piperidinecarbonitrile
Description:
4-Amino-4-piperidinecarbonitrile, with the CAS number 50289-05-9, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the piperidine ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the amino group makes it a basic compound, while the cyano group can participate in various chemical reactions, including nucleophilic additions and cycloadditions. 4-Amino-4-piperidinecarbonitrile is typically a solid at room temperature and may exhibit solubility in polar solvents due to the functional groups present. Its unique structure allows it to serve as a building block in the synthesis of pharmaceuticals and agrochemicals, particularly in the development of compounds targeting neurological disorders or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H11N3
InChI:InChI=1S/C6H11N3/c7-5-6(8)1-3-9-4-2-6/h9H,1-4,8H2
InChI key:InChIKey=YRQZAUSIVGMFNN-UHFFFAOYSA-N
SMILES:C(#N)C1(N)CCNCC1
Synonyms:- 4-Piperidinecarbonitrile, 4-amino-
- 4-Amino-4-piperidinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Amino-4-piperidinecarbonitrile
CAS:Controlled ProductFormula:C6H11N3Color and Shape:NeatMolecular weight:125.172
