CymitQuimica logo

CAS 50295-20-0

:

2-[(2,6-dimethylphenyl)amino]-N-ethyl-N-methyl-2-oxoethanaminium chloride

Description:
2-[(2,6-dimethylphenyl)amino]-N-ethyl-N-methyl-2-oxoethanaminium chloride, with CAS number 50295-20-0, is a quaternary ammonium compound characterized by its complex structure, which includes an amine group, an oxo group, and a chloride ion. This compound typically exhibits properties associated with quaternary ammonium salts, such as being soluble in water and organic solvents, and possessing antimicrobial activity. The presence of the dimethylphenyl group contributes to its hydrophobic characteristics, while the quaternary ammonium structure imparts cationic properties, making it useful in various applications, including as a surfactant or antimicrobial agent. Its stability and reactivity can be influenced by the surrounding pH and temperature, and it may participate in ionic interactions due to its charged nature. Safety data sheets should be consulted for handling and potential hazards, as quaternary ammonium compounds can be irritants and may pose environmental risks. Overall, this compound's unique structure and properties make it of interest in both industrial and research settings.
Formula:C13H21ClN2O
InChI:InChI=1/C13H20N2O.ClH/c1-5-15(4)9-12(16)14-13-10(2)7-6-8-11(13)3;/h6-8H,5,9H2,1-4H3,(H,14,16);1H
InChI key:APBBVJVUJAPCDX-UHFFFAOYSA-N
SMILES:CCN(C)CC(=Nc1c(C)cccc1C)O.Cl
Found 5 products.