
CAS 503-05-9
:Malvalic acid
Description:
Malvalic acid is a naturally occurring fatty acid classified as a dicarboxylic acid, primarily derived from the seeds of the Malvaceae family, particularly from the hibiscus plant. It is characterized by its long carbon chain, which typically contains 18 carbon atoms, and features two carboxylic acid functional groups (-COOH) at each end of the molecule. This structure contributes to its properties, including its potential as a surfactant and emulsifying agent. Malvalic acid is known for its relatively low solubility in water, but it is soluble in organic solvents, making it useful in various chemical applications. Additionally, it exhibits biological activity, which has drawn interest in the fields of pharmacology and biochemistry. The compound is also studied for its potential role in the synthesis of other chemical derivatives and its applications in the food and cosmetic industries. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation or adverse reactions.
Formula:C18H32O2
InChI:InChI=1S/C18H32O2/c1-2-3-4-5-6-9-12-16-15-17(16)13-10-7-8-11-14-18(19)20/h2-15H2,1H3,(H,19,20)
InChI key:InChIKey=HPSSZFFAYWBIPY-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)C1=C(CCCCCCCC)C1
Synonyms:- Malvalic acid
- Halphen acid
- Malvic acid
- 1-Cyclopropene-1-heptanoic acid, 2-octyl-
- 2-Octyl-1-cyclopropene-1-heptanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
