CymitQuimica logo

CAS 503089-88-1

:

4-iodoisoquinolin-3-amine

Description:
4-Iodoisoquinolin-3-amine is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring system. The presence of an amino group (-NH2) at the 3-position and an iodine atom at the 4-position of the isoquinoline ring contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its iodine substituent can influence its electronic properties, making it a potential candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The amino group can participate in hydrogen bonding and may enhance the compound's interaction with biological targets. Additionally, 4-iodoisoquinolin-3-amine may serve as a useful intermediate in organic synthesis, allowing for further functionalization and derivatization. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental considerations.
Formula:C9H7IN2
InChI:InChI=1/C9H7IN2/c10-8-7-4-2-1-3-6(7)5-12-9(8)11/h1-5H,(H2,11,12)
InChI key:DLFHLPVYTLXMSB-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=NC(=C2I)N
Synonyms:
  • 4-Iodoisoquinolin-3-amine
  • 3-isoquinolinamine, 4-iodo-
Found 3 products.