CAS 503184-34-7
:pyridine, 3-iodo-6-methoxy-2-(trifluoromethyl)-
Description:
Pyridine, 3-iodo-6-methoxy-2-(trifluoromethyl)-, identified by CAS number 503184-34-7, is a heterocyclic organic compound featuring a pyridine ring substituted with various functional groups. The presence of an iodine atom at the 3-position and a methoxy group at the 6-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The trifluoromethyl group at the 2-position enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. Pyridine derivatives are known for their aromatic properties and can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. This compound may exhibit specific physical properties such as solubility in organic solvents and distinct spectral characteristics in NMR and IR analyses. Its potential applications could range from serving as an intermediate in the synthesis of more complex molecules to acting as a ligand in coordination chemistry. Overall, the unique combination of substituents in this pyridine derivative makes it a valuable compound for further study in chemical and pharmaceutical contexts.
Formula:C7H5F3INO
InChI:InChI=1/C7H5F3INO/c1-13-5-3-2-4(11)6(12-5)7(8,9)10/h2-3H,1H3
SMILES:COc1ccc(c(C(F)(F)F)n1)I
Synonyms:- 3-Iodo-6-Methoxy-2-(Trifluoromethyl)Pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Iodo-6-methoxy-2-(trifluoromethyl)pyridine
CAS:Controlled ProductApplications 3-Iodo-6-methoxy-2-(trifluoromethyl)pyridine is used in the synthesis of biologically active compounds containing a trifluoromethyl moiety.
Formula:C7H5F3INOColor and Shape:NeatMolecular weight:303.02

