CAS 5032-13-3
:4-[(hydroxyamino)methylidene]-2,6-dimethoxycyclohexa-2,5-dien-1-one
Description:
4-[(Hydroxyamino)methylidene]-2,6-dimethoxycyclohexa-2,5-dien-1-one, with the CAS number 5032-13-3, is an organic compound characterized by its complex structure featuring a cyclohexadiene core. This compound contains functional groups such as a hydroxyamino group and methoxy groups, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the hydroxyamino group suggests that it may participate in nucleophilic reactions, while the methoxy groups can influence its electronic properties and solubility. The compound is likely to exhibit interesting optical properties due to its conjugated system, which may also affect its stability and reactivity under different conditions. Additionally, its structural features may allow for interactions with biological systems, making it a candidate for further investigation in medicinal chemistry or as a synthetic intermediate. Overall, this compound's unique characteristics stem from its specific arrangement of atoms and functional groups, which dictate its chemical behavior and potential applications.
Formula:C9H11NO4
InChI:InChI=1/C9H11NO4/c1-13-7-3-6(5-10-12)4-8(14-2)9(7)11/h3-5,10,12H,1-2H3
SMILES:COC1=CC(=CNO)C=C(C1=O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Syringaldoxime
CAS:Syringaldoxime is a tyrosinase inhibitor that inhibits the production of melanin. It is used in the treatment of vitiligo, a skin condition characterized by patches of depigmented skin. Syringaldoxime binds to benzal-dioxime and inhibits its activity. This inhibition leads to decreased production of hydroxytyrosine, which is an important intermediate in the synthesis of melanin. It also has inhibitory activity against l-dopa oxidation and enzyme catalyzed reactions. Syringaldoxime has two moieties, tropolone and methoxy, which are responsible for its inhibitory effects on tyrosinase activity.
Formula:C9H11NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:197.19 g/molRef: 3D-FS70375
Discontinued product
