CAS 5032-13-3: 4-[(hydroxyamino)methylidene]-2,6-dimethoxycyclohexa-2,5-dien-1-one

Description:4-[(Hydroxyamino)methylidene]-2,6-dimethoxycyclohexa-2,5-dien-1-one, with the CAS number 5032-13-3, is an organic compound characterized by its complex structure featuring a cyclohexadiene core. This compound contains functional groups such as a hydroxyamino group and methoxy groups, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the hydroxyamino group suggests that it may participate in nucleophilic reactions, while the methoxy groups can influence its electronic properties and solubility. The compound is likely to exhibit interesting optical properties due to its conjugated system, which may also affect its stability and reactivity under different conditions. Additionally, its structural features may allow for interactions with biological systems, making it a candidate for further investigation in medicinal chemistry or as a synthetic intermediate. Overall, this compound's unique characteristics stem from its specific arrangement of atoms and functional groups, which dictate its chemical behavior and potential applications.

Formula:C₉H₁₁NO₄

InChI:InChI=1/C9H11NO4/c1-13-7-3-6(5-10-12)4-8(14-2)9(7)11/h3-5,10,12H,1-2H3