CAS 503293-47-8
:5-(2-chloro-6-fluorophenyl)-2H-tetrazole
Description:
5-(2-Chloro-6-fluorophenyl)-2H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of the 2-chloro-6-fluorophenyl group indicates that the compound has a phenyl ring substituted with both chlorine and fluorine atoms, contributing to its unique chemical properties. This compound is often studied for its potential applications in pharmaceuticals, particularly as a building block in drug synthesis due to the bioactivity associated with tetrazole derivatives. It may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, depending on its specific structure and substituents. The compound's solubility, stability, and reactivity can be influenced by the presence of the halogen substituents, which can affect its interactions with biological targets. As with many tetrazole derivatives, it may also be of interest in the development of agrochemicals or other specialty chemicals. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C7H4ClFN4
InChI:InChI=1/C7H4ClFN4/c8-4-2-1-3-5(9)6(4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13)
SMILES:c1cc(c(c(c1)F)c1n[nH]nn1)Cl
Synonyms:- 5-(2-Chloro-6-fluoro-phenyl)-2H-tetrazole
- 6-Chloro-2-Fluorobenzotetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(2-Chloro-6-fluorophenyl)-2H-tetrazole
CAS:5-(2-Chloro-6-fluorophenyl)-2H-tetrazole
Molecular weight:198.58g/mol
