CAS 503309-11-3
:2-Fluoro-4-(trifluoromethyl)benzeneboronic acid
Description:
2-Fluoro-4-(trifluoromethyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorinated aromatic ring. The molecular structure features a fluorine atom at the ortho position and a trifluoromethyl group at the para position relative to the boronic acid group on a benzene ring. This compound is typically used in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, which is valuable for forming carbon-carbon bonds. The presence of multiple fluorine atoms enhances its lipophilicity and can influence its reactivity and solubility in various solvents. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various applications, including drug development and materials science. The compound's unique electronic and steric properties, derived from its fluorinated substituents, contribute to its utility in synthetic chemistry and potential applications in pharmaceuticals.
Formula:C7H5BF4O2
InChI:InChI=1/C7H5BF4O2/c9-6-3-4(7(10,11)12)1-2-5(6)8(13)14/h1-3,13-14H
SMILES:c1cc(c(cc1C(F)(F)F)F)B(O)O
Synonyms:- 2-Fluoro-4-(Trifluoromethyl)Phenylboronic Acid
- (2,2,2-Trifluoroethyl)Hydrazine
- 2-Fluoro-4-(trifluoromethyl)benzeneboronicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Fluoro-4-(trifluoromethyl)benzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BF4O2Purity:97%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:207.922-Fluoro-4-(trifluoromethyl)benzeneboronic acid
CAS:2-Fluoro-4-(trifluoromethyl)benzeneboronic acidFormula:C7H5BF4O2Purity:99%Color and Shape:White Solid-PowderMolecular weight:207.91801Boronic acid, [2-fluoro-4-(trifluoromethyl)phenyl]-
CAS:Formula:C7H5BF4O2Purity:97%Color and Shape:SolidMolecular weight:207.91802-Fluoro-4-(trifluoromethyl)phenylboronic acid
CAS:Formula:C7H5BF4O2Purity:97.0%Color and Shape:SolidMolecular weight:207.922-Fluoro-4-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H5BF4O2Color and Shape:White to Light yellow powder to crystalMolecular weight:207.92[2-fluoro-4-(trifluoromethyl)phenyl]boronic Acid
CAS:2-Fluoro-4-(trifluoromethyl)phenylboronic acid is a boron compound that can be used to synthesize a variety of target products. 2-Fluoro-4-(trifluoromethyl)phenylboronic acid occurs in the form of an oil and is an impurity in the target product, phenylboronic acid. This impurity can be removed by reacting with lithium benzotrifluoride. Lithiated 2-fluoro-4-(trifluoromethyl)phenylboronic acid is then reacted with phenylboronic acid to give lithiated phenylboronic ester in high yield. The lithiation reaction can be carried out under alkaline conditions or under a condition where the reactants are dissolved in water.Formula:C7H5BF4O2Purity:Min. 95%Molecular weight:207.92 g/mol






