CAS 50335-03-0
:Chaetoglobosin A
Description:
Chaetoglobosin A is a natural compound classified as a secondary metabolite, primarily produced by certain fungi, particularly those in the Chaetomium genus. It is known for its complex structure, which includes a fused bicyclic system and multiple functional groups, contributing to its biological activity. Chaetoglobosin A exhibits notable antifungal and cytotoxic properties, making it of interest in pharmaceutical research. Its mechanism of action often involves the disruption of cellular processes in target organisms, which can lead to cell death. The compound is typically isolated from fungal cultures and has been studied for its potential applications in medicine, particularly in the development of new antimicrobial agents. Additionally, its unique structural features and biological activities make it a subject of interest in the field of natural product chemistry. As with many natural compounds, the study of Chaetoglobosin A also raises considerations regarding its synthesis, extraction, and potential environmental impact.
Formula:C32H36N2O5
InChI:InChI=1S/C32H36N2O5/c1-17-8-7-10-22-29-31(4,39-29)19(3)27-24(15-20-16-33-23-11-6-5-9-21(20)23)34-30(38)32(22,27)26(36)13-12-25(35)28(37)18(2)14-17/h5-7,9-14,16-17,19,22,24,27-29,33,37H,8,15H2,1-4H3,(H,34,38)/b10-7+,13-12+,18-14+/t17-,19-,22-,24-,27-,28+,29-,31+,32+/m0/s1
InChI key:InChIKey=OUMWCYMRLMEZJH-VOXRAUTJSA-N
SMILES:O=C1[C@]23[C@]([C@H](CC=4C=5C(NC4)=CC=CC5)N1)([C@H](C)[C@]6(C)[C@]([C@@]2(/C=C/C[C@H](C)/C=C(\C)/[C@@H](O)C(=O)\C=C\C3=O)[H])(O6)[H])[H]
Synonyms:- (13)Cytochalasa-13,17,21-triene-1,20,23-trione, 6,7-epoxy-19-hydroxy-10-(1H-indol-3-yl)-16,18-dimethyl-, (7S,13E,16S,17E,19R,21E)-
- (1E,4S,5E,7R,9E,11aR,14S,14aR,15S,15aR,16aS,16bR)-4,7,14,14a,15,15a,16a,16b-Octahydro-7-hydroxy-14-(1H-indol-3-ylmethyl)-4,6,15,15a-tetramethyl-3H-cyclotridec[d]oxireno[f]isoindole-8,11,12(13H)-trione
- (1E,4S,5E,7R,9E,11aR,14S,14aR,15S,15aR,16aS,16bR)-7-hydroxy-14-(1H-indol-3-ylmethyl)-4,6,15,15a-tetramethyl-4,7,14,14a,15,15a,16a,16b-octahydro-3H-cyclotrideca[d]oxireno[f]isoindole-8,11,12(13H)-trione
- 3H-Cyclotridec[d]oxireno[f]isoindole-8,11,12(13H)-trione, 4,7,14,14a,15,15a,16a,16b-octahydro-7-hydroxy-14-(1H-indol-3-ylmethyl)-4,6,15,15a-tetramethyl-, (1E,4S,5E,7R,9E,11aR,14S,14aR,15S,15aR,16aS,16bR)-
- 3H-Cyclotridec[d]oxireno[f]isoindole-8,11,12(13H)-trione, 4,7,14,14a,15,15a,16a,16b-octahydro-7-hydroxy-14-(1H-indol-3-ylmethyl)-4,6,15,15a-tetramethyl-, [4S-(1E,4R*,5E,7S*,9E,11aS*,14R*,14aS*,15R*,15aS*,16aR*,16bS*)]-
- Brn 1097707
- Chaetoglobosins
- Nsc 366739
- Chaetoglobosin A
- Chaetoglobosin A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Chaetoglobosin A
CAS:<p>Chaetoglobosin A, the active compound extracted of Penicillium aquamarinium, is a member of the cytochalasan family. It preferentially induces apoptosis.</p>Formula:C32H36N2O5Purity:98%Color and Shape:SolidMolecular weight:528.649Chaetoglobosin A - From chaetomium globosum
CAS:<p>Chaetoglobosin A is a mycotoxin, which is a secondary metabolite produced by the fungus Chaetomium globosum. This compound exhibits its mode of action by disrupting the cytoskeletal elements within cells, primarily affecting actin polymerization. This interference leads to alterations in cell morphology and can induce apoptosis in certain cell lines.</p>Formula:C32H36N2O5Purity:Min. 95%Molecular weight:528.64 g/mol




