CAS 50337-85-4

4-Fluoro-δ-(4-fluorophenyl)benzenebutanol

Description:

4-Fluoro-δ-(4-fluorophenyl)benzenebutanol, with the CAS number 50337-85-4, is a chemical compound characterized by its structural features, which include a butanol moiety and two fluorine substituents on the aromatic rings. This compound typically exhibits properties associated with both alcohols and aromatic compounds, such as moderate solubility in polar solvents and potential hydrophobic characteristics due to its aromatic structure. The presence of fluorine atoms can influence its reactivity, stability, and biological activity, often enhancing lipophilicity and altering interaction with biological targets. The compound may be of interest in medicinal chemistry and materials science due to its unique structural attributes. Additionally, its synthesis and handling require careful consideration of safety protocols, particularly due to the presence of fluorinated groups, which can pose environmental and health risks. Overall, 4-Fluoro-δ-(4-fluorophenyl)benzenebutanol represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and chemical research.

Formula: C₁₆H₁₆F₂O

InChI: InChI=1S/C16H16F2O/c17-14-7-3-12(4-8-14)16(2-1-11-19)13-5-9-15(18)10-6-13/h3-10,16,19H,1-2,11H2

InChI key: InChIKey=BMPMPXFWCYAFJO-UHFFFAOYSA-N

SMILES: C(CCCO)(C1=CC=C(F)C=C1)C2=CC=C(F)C=C2

Synonyms:

• 4,4-Bis(4-fluorophenyl)butan-1-ol
• Benzenebutanol, 4-fluoro-δ-(4-fluorophenyl)-
• 4,4-Bis(4-fluorophenyl)-1-butanol
• 4,4-Bis(4-fluorophenyl)butanol
• 4-Fluoro-δ-(4-fluorophenyl)benzenebutanol

Pimozide Impurity 5

CAS: 50337-85-4

Formula: C₁₆H₁₆F₂O

Molecular weight: 262.30

Ref: 4Z-P-8013

4-Fluoro-δ-(4-fluorophenyl)benzenebutanol

Controlled Product

CAS: 50337-85-4

Formula: C₁₆H₁₆F₂O

Color and Shape: Neat

Molecular weight: 262.294

Ref: TR-F591810