CAS 5034-06-0
:Sulfoxonium, trimethyl-, chloride
Description:
Sulfoxonium, trimethyl-, chloride is an organosulfur compound characterized by the presence of a sulfoxonium group, which features a sulfur atom bonded to an oxygen atom and three methyl groups, along with a chloride ion. This compound is typically a white crystalline solid that is soluble in polar solvents. It exhibits properties associated with both sulfoxides and quaternary ammonium salts, making it a versatile reagent in organic synthesis. Sulfoxonium salts are known for their ability to act as oxidizing agents and can participate in various chemical reactions, including the formation of sulfoxides from sulfides. Additionally, they may serve as intermediates in the synthesis of more complex molecules. Due to its quaternary structure, trimethyl sulfoxonium chloride can also exhibit unique reactivity patterns, such as nucleophilic substitution. Safety data indicates that, like many organosulfur compounds, it should be handled with care, as it may pose health risks upon exposure. Proper laboratory practices should be followed when working with this compound.
Formula:C3H9OS·Cl
InChI:InChI=1S/C3H9OS.ClH/c1-5(2,3)4;/h1-3H3;1H/q+1;/p-1
InChI key:InChIKey=KQYWHJICYXXDSQ-UHFFFAOYSA-M
SMILES:[S+](C)(C)(C)=O.[Cl-]
Synonyms:- NSC 221182
- Sulfoxonium, trimethyl-, chloride
- Trimethyl sulfoxide Chloride
- Trimethyloxosulfonium chloride
- Trimethylsulfonium chloride, oxide
- Trimethylsulfoxonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Trimethylsulfoxonium Chloride
CAS:Formula:C3H9ClOSPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:128.61Trimethylsulfoxonium chloride
CAS:Formula:C3H9ClOSPurity:95%Color and Shape:SolidMolecular weight:128.6210Trimethylsulphoxonium chloride
CAS:<p>Trimethylsulphoxonium chloride</p>Formula:C3H9OS·ClPurity:≥95%Color and Shape: white solidMolecular weight:128.62g/molTrimethylsulfoxonium chloride
CAS:<p>Trimethylsulfoxonium chloride is a quaternary ammonium salt that is used as a phospholipid membrane disruptor. It has been studied for its clinical profile and antiviral activity in vitro. Trimethylsulfoxonium chloride also has anti-fungal and anticancer properties, which are due to its ability to inhibit the synthesis of lipid-containing macromolecules. This drug may be useful as a growth regulator in plants. Trimethylsulfoxonium chloride is prepared by an asymmetric synthesis using acetone and ethyl chloroacetate. The reaction mechanism is not well understood but it may involve the addition of the thiol group to the sulfur atom of the sulfoxide ion, followed by hydrolysis of the phosphate ester and elimination of water.</p>Formula:C3H9OS•ClPurity:Min. 95%Color and Shape:White SolidMolecular weight:128.62 g/molTrimethyl sulfoxonium chloride
CAS:Formula:C3H9ClOSPurity:95%Color and Shape:SolidMolecular weight:128.61
