CAS 5034-74-2
:5-Bromo-3-methoxysalicylaldehyde
Description:
5-Bromo-3-methoxysalicylaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a salicylaldehyde framework. The presence of the bromine atom typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and organic synthesis. The methoxy group contributes to the compound's solubility and can influence its electronic properties, potentially affecting its reactivity and interaction with biological targets. As a salicylaldehyde derivative, it features an aldehyde functional group, which is known for its ability to participate in condensation reactions and form various derivatives. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structural features suggest potential applications in dye synthesis and as a ligand in coordination chemistry. Overall, 5-Bromo-3-methoxysalicylaldehyde is a versatile compound with significant implications in both academic and industrial chemistry.
Formula:C8H7BrO3
InChI:InChI=1/C8H7BrO3/c1-12-7-3-6(9)2-5(4-10)8(7)11/h2-4,11H,1H3
SMILES:COc1cc(cc(C=O)c1O)Br
Synonyms:- Benzaldehyde, 5-Bromo-2-Hydroxy-3-Methoxy-
- 5-Bromo-2-Hydroxy-3-Methoxybenzaldehyde
- 5-BROMO-3-METHOXYSALICYLALDEHYDE
- 5-BROMO-2-VANILLIN
- 5-BROMO-2-HYDROXY-3-METHOXYBENZALDEHYDE 98%
- BUTTPARK 153\33-74
- 5-BROMO-O-VANILLIN
- OTAVA-BB BB7018802005
- 5-BROMO-2-HYDROXY-3-METHOXYBENZENECARBALDEHYDE
- 3-Methoxy-5-bromosalicylaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-3-methoxysalicylaldehyde, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H7BrO3Purity:97%Color and Shape:Crystals or powder or crystalline powder, Pale cream to Pale brown to brownMolecular weight:231.055-Bromo-2-hydroxy-3-methoxybenzaldehyde
CAS:Formula:C8H7BrO3Purity:98%Color and Shape:SolidMolecular weight:231.04345-Bromo-2-hydroxy-3-methoxybenzaldehyde
CAS:5-Bromo-2-hydroxy-3-methoxybenzaldehydePurity:≥95%Color and Shape:SolidMolecular weight:231.04g/mol5-Bromo-2-hydroxy-3-methoxybenzaldehyde
CAS:5-Bromo-2-hydroxy-3-methoxybenzaldehyde is an antibacterial agent that inhibits bacterial growth by binding to the active site of DNA gyrase. It has been shown to interact with the nitrogen atoms in the active site of DNA gyrase, inhibiting its function and preventing the formation of a molecule that is essential for cell division. 5-Bromo-2-hydroxy-3-methoxybenzaldehyde binds to the diffraction molecules in a single crystal x-ray diffraction experiment. The hydrogen bonds formed between 5-bromo 2 hydroxy 3 methoxybenzaldehyde and oxygen atoms are responsible for this interaction.Formula:C8H7BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:231.04 g/mol5-Bromo-2-hydroxy-3-methoxybenzaldehyde
CAS:Formula:C8H7BrO3Purity:97%Color and Shape:SolidMolecular weight:231.045




