
CAS 5034-77-5
:5-[3,3-Bis(2-chloroethyl)-1-triazenyl]-1H-imidazole-4-carboxamide
Description:
5-[3,3-Bis(2-chloroethyl)-1-triazenyl]-1H-imidazole-4-carboxamide, with CAS number 5034-77-5, is a chemical compound that belongs to the class of triazene derivatives. It is characterized by the presence of a triazene functional group, which is known for its potential as an antitumor agent due to its ability to release reactive species that can damage DNA. The imidazole ring contributes to its biological activity, as imidazole derivatives often exhibit various pharmacological properties. This compound is typically synthesized through a multi-step process involving the reaction of appropriate precursors. Its structure includes two chloroethyl groups, which enhance its reactivity and potential for alkylation of nucleophilic sites in biological molecules. The compound's properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Due to its biological activity, it has been studied for its potential use in cancer therapy, although safety and efficacy must be thoroughly evaluated in clinical settings.
Formula:C8H12Cl2N6O
InChI:InChI=1S/C8H12Cl2N6O/c9-1-3-16(4-2-10)15-14-8-6(7(11)17)12-5-13-8/h5H,1-4H2,(H2,11,17)(H,12,13)
InChI key:InChIKey=XWRSGLHADOYUFN-UHFFFAOYSA-N
SMILES:N(=NN(CCCl)CCCl)C1=C(C(N)=O)N=CN1
Synonyms:- 5-[3,3-Bis(2-chloroethyl)-1-triazenyl]-1H-imidazole-4-carboxamide
- Imidazole-4(or 5)-carboxamide, 5(or 4)-[3,3-bis(2-chloroethyl)-1-triazeno]-
- NSC 82196
- 1H-Imidazole-4-carboxamide, 5-[3,3-bis(2-chloroethyl)-1-triazenyl]-
- Imidazole-4-carboxamide, 5-[3,3-bis(2-chloroethyl)-1-triazeno]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Imidazole mustard
CAS:Imidazole mustard is an inhibitor of purine nucleoside synthesis.Formula:C8H12Cl2N6OColor and Shape:SolidMolecular weight:279.13
