CAS 503417-34-3

1-[3-(Trifluoromethyl)phenyl]cyclopropanamine

Description:

1-[3-(Trifluoromethyl)phenyl]cyclopropanamine, with the CAS number 503417-34-3, is a chemical compound characterized by its unique structural features. It consists of a cyclopropane ring bonded to an amine group and a phenyl ring that is further substituted with a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Additionally, the cyclopropane moiety can impart strain, which may contribute to reactivity and interaction with biological targets. Overall, 1-[3-(Trifluoromethyl)phenyl]cyclopropanamine represents a class of compounds that could be valuable in various chemical and pharmaceutical applications, warranting further investigation into its properties and potential uses.

Formula: C₁₀H₁₀F₃N

InChI: InChI=1/C10H10F3N/c11-10(12,13)8-3-1-2-7(6-8)9(14)4-5-9/h1-3,6H,4-5,14H2

SMILES: c1cc(cc(c1)C(F)(F)F)C1(CC1)N

Synonyms:

• 1-[3-(Trifluormethyl)phenyl]cyclopropanamin
• Cyclopropanamine, 1-[3-(Trifluoromethyl)Phenyl]-
• 1-[3-(Trifluoromethyl)phenyl]-cyclopropanamine

Cyclopropanamine, 1-[3-(trifluoromethyl)phenyl]-

CAS: 503417-34-3

Formula: C₁₀H₁₀F₃N

Purity: 98%

Color and Shape: Liquid

Molecular weight: 201.1883

Ref: IN-DA00I919

1-[3-(Trifluoromethyl)phenyl]cyclopropan-1-amine

CAS: 503417-34-3

1-[3-(Trifluoromethyl)phenyl]cyclopropan-1-amine

Molecular weight: 201.18831g/mol

Ref: 54-PC106501

1-(3-(TRIFLUOROMETHYL)PHENYL)CYCLOPROPANAMINE

CAS: 503417-34-3

Purity: 98%

Molecular weight: 201.1920013

Ref: 10-F805883