CAS 503468-95-9
:8-(dibenzo[b,d]thiophen-4-yl)-2-(morpholin-4-yl)-4H-chromen-4-one
Description:
The chemical substance known as 8-(dibenzo[b,d]thiophen-4-yl)-2-(morpholin-4-yl)-4H-chromen-4-one, with the CAS number 503468-95-9, is a synthetic organic compound characterized by its complex structure, which includes a chromenone core, a dibenzo[b,d]thiophene moiety, and a morpholine substituent. This compound typically exhibits properties such as fluorescence and potential biological activity, making it of interest in medicinal chemistry and materials science. Its structure suggests it may interact with various biological targets, potentially leading to applications in drug development. The presence of the morpholine ring can enhance solubility and bioavailability, while the dibenzo[b,d]thiophene unit may contribute to its electronic properties. Additionally, the chromenone framework is known for its versatility in organic synthesis and its role in various chemical reactions. Overall, this compound represents a unique combination of structural features that may confer interesting chemical and biological properties, warranting further investigation for potential applications in pharmaceuticals or as a fluorescent probe.
Formula:C25H19NO3S
InChI:InChI=1/C25H19NO3S/c27-21-15-23(26-11-13-28-14-12-26)29-24-17(6-3-9-20(21)24)19-8-4-7-18-16-5-1-2-10-22(16)30-25(18)19/h1-10,15H,11-14H2
SMILES:c1ccc2c(c1)c1cccc(c3cccc4c(=O)cc(N5CCOCC5)oc34)c1s2
Synonyms:- 8-(dibenzo[b,d]thiophen-4-yl)-2-morpholino-4H-chromen-4-one
- Nu7441
- Ku 57788
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
KU-57788
CAS:NU7441 (KU-57788 (NU7441)) is a highly effective and specific DNA-PK inhibitor (IC50: 14 nM).Formula:C25H19NO3SPurity:98% - >99.99%Color and Shape:SolidMolecular weight:413.49NU 7441
CAS:Controlled ProductApplications A potent novel DNA-dependent protein kinase inhibitor models of human cancer. Antitumor agent.
References Caldecott, K., et al.: Cancer Res., 50, 5778 (1990), Boulton, S., et al.: Eur. J. Cancer, 36, 535 (2000), Jackson, S., et al.: Carcinogenesis, 23, 687 (2002), Sandler, A., et al.: Semin. Oncol., 30, 9 (2003), Hardcastle, I., et al.: J. Med. Chem., 48, 7829 (2005),Formula:C25H19NO3SColor and Shape:NeatMolecular weight:413.49



