CymitQuimica logo

CAS 503536-77-4

:

5-[4-(Dimethylamino)phenyl]-2-pyridinamine

Description:
5-[4-(Dimethylamino)phenyl]-2-pyridinamine, with the CAS number 503536-77-4, is an organic compound characterized by its structure, which includes a pyridine ring and a dimethylamino group attached to a phenyl moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals or as a chemical intermediate due to its ability to participate in various chemical reactions. The presence of the dimethylamino group suggests that it may exhibit basic properties, allowing it to form salts with acids. Additionally, the compound may display specific optical properties, making it useful in dye applications or as a fluorescent marker. Its solubility can vary depending on the solvent, and it may be sensitive to light or air, necessitating careful handling and storage. Overall, the unique combination of functional groups in this compound contributes to its reactivity and potential utility in various chemical contexts.
Formula:C13H15N3
InChI:InChI=1/C13H15N3/c1-16(2)12-6-3-10(4-7-12)11-5-8-13(14)15-9-11/h3-9H,1-2H3,(H2,14,15)
SMILES:CN(C)c1ccc(cc1)c1ccc(=N)[nH]c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.