CymitQuimica logo

CAS 50355-68-5

:

(2S)-{[(2S,4R)-2-amino-5-(carbamoyloxy)-4-hydroxypentanoyl]amino}[(3S,4R,5R)-5-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]ethanoic acid (non-preferred name)

Description:
The chemical substance with the name "(2S)-{[(2S,4R)-2-amino-5-(carbamoyloxy)-4-hydroxypentanoyl]amino}[(3S,4R,5R)-5-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]ethanoic acid" and CAS number "50355-68-5" is a complex organic compound characterized by its multi-functional groups, including amino acids, hydroxyl groups, and a fluorinated pyrimidine derivative. This compound exhibits properties typical of peptides and amino acid derivatives, such as solubility in polar solvents and potential biological activity. The presence of a carbamoyloxy group suggests it may participate in various biochemical reactions, while the fluorinated moiety could enhance its pharmacological properties. The stereochemistry indicated by the (S) and (R) designations implies specific spatial arrangements that are crucial for its biological interactions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. Its structural complexity and functional diversity make it a subject of interest for further research in drug design and development.
Formula:C16H22FN5O11
InChI:InChI=1/C16H22FN5O11/c17-5-2-22(16(31)21-11(5)26)13-9(25)8(24)10(33-13)7(14(28)29)20-12(27)6(18)1-4(23)3-32-15(19)30/h2,4,6-10,13,23-25H,1,3,18H2,(H2,19,30)(H,20,27)(H,28,29)(H,21,26,31)/t4-,6+,7+,8+,9-,10?,13-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.