CAS 503620-39-1

(2E)-3-[4,5,6,7-Tetrahydro-4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-2-benzofuranyl]-2-propenoic acid

Description:

The chemical substance known as (2E)-3-[4,5,6,7-Tetrahydro-4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-2-benzofuranyl]-2-propenoic acid, with CAS number 503620-39-1, is a complex organic compound characterized by its unique structural features. It contains multiple fused ring systems, including a naphthalene derivative and a benzofuran moiety, which contribute to its potential biological activity. The presence of the propenoic acid functional group indicates that it may participate in various chemical reactions, such as polymerization or esterification. The compound's tetrahydro and tetramethyl groups suggest a degree of steric hindrance, which can influence its reactivity and interactions with biological targets. Additionally, the stereochemistry denoted by (2E) indicates a specific geometric configuration around the double bond, which can affect the compound's physical properties and biological efficacy. Overall, this substance may have applications in medicinal chemistry or as a synthetic intermediate, although specific biological activities and properties would require further investigation.

Formula: C₂₅H₃₀O₃

InChI: InChI=1/C25H30O3/c1-24(2)12-13-25(3,4)21-14-16(8-10-20(21)24)18-6-5-7-22-19(18)15-17(28-22)9-11-23(26)27/h8-11,14-15,18H,5-7,12-13H2,1-4H3,(H,26,27)/b11-9+

InChI key: InChIKey=WRWCAQNPEXYGJK-PKNBQFBNNA-N

SMILES: C(=C/C(O)=O)\C1=CC=2C(CCCC2O1)C=3C=C4C(=CC3)C(C)(C)CCC4(C)C

Synonyms:

• 2-Propenoic acid, 3-[4,5,6,7-tetrahydro-4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-2-benzofuranyl]-, (2E)-
• (2E)-3-[4,5,6,7-Tetrahydro-4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-2-benzofuranyl]-2-propenoic acid

GW0791

CAS: 503620-39-1

GW0791 is a retinoid X receptor α (RXRα) agonist.

Formula: C₂₅H₃₀O₃

Color and Shape: Solid

Molecular weight: 378.5

Ref: TM-T25472