CAS 5037-75-2

3-benzylpiperazine-2,5-dione

Description:

3-Benzylpiperazine-2,5-dione, with the CAS number 5037-75-2, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group attached to the piperazine ring, contributing to its aromatic properties. The presence of the dione functional groups indicates that there are two carbonyl (C=O) groups within the structure, specifically at the 2 and 5 positions of the piperazine ring. This configuration can influence the compound's reactivity and potential biological activity. 3-Benzylpiperazine-2,5-dione is typically a solid at room temperature and may exhibit solubility in organic solvents. Its unique structure allows it to participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, compounds with similar structures have been studied for their potential pharmacological effects, including their role as psychoactive substances or in the treatment of various medical conditions.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1/C11H12N2O2/c14-10-7-12-11(15)9(13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,15)(H,13,14)

SMILES: c1ccc(cc1)CC1C(=NCC(=N1)O)O

Synonyms:

• 2,5-Piperazinedione, 3-(phenylmethyl)-

Cyclo(Phe-Gly)

CAS: 5037-75-2

Cyclo(Phe-Gly)

Purity: 98%

Molecular weight: 204.23g/mol

Ref: 54-OR1034118

Cyclo(Phe-Gly)

CAS: 5037-75-2

Purity: 98%

Molecular weight: 204.09

Ref: 10-F555093

3-Benzylpiperazine-2,5-dione

Controlled Product

CAS: 5037-75-2

Applications 3-Benzylpiperazine-2,5-dione (cas# 5037-75-2) is a useful research chemical.

Formula: C₁₁H₁₂N₂O₂

Color and Shape: Neat

Molecular weight: 204.225

Ref: TR-B289383