CAS 50371-65-8

4,5-dibromo-1H-pyrrole-2-carbohydrazide

Description:

4,5-Dibromo-1H-pyrrole-2-carbohydrazide is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with two bromine atoms and a carbohydrazide functional group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of bromine atoms enhances its reactivity, making it useful in synthetic chemistry. The carbohydrazide moiety can participate in various chemical reactions, such as hydrazone formation and coupling reactions, which are valuable in organic synthesis. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on further studies. Its solubility and stability can vary based on the solvent and environmental conditions. As with many brominated compounds, safety precautions should be taken during handling due to potential toxicity and environmental concerns. Overall, 4,5-dibromo-1H-pyrrole-2-carbohydrazide is a versatile compound with significant implications in research and development.

Formula: C₅H₅Br₂N₃O

InChI: InChI=1/C5H5Br2N3O/c6-2-1-3(5(11)10-8)9-4(2)7/h1,9H,8H2,(H,10,11)

SMILES: c1c(c(Br)[nH]c1C(=O)NN)Br

4,5-Dibromo-1H-pyrrole-2-carbohydrazide

CAS: 50371-65-8

Formula: C₅H₅Br₂N₃O

Color and Shape: Solid

Molecular weight: 282.9207

Ref: IN-DA006U7H

4,5-Dibromo-1H-pyrrole-2-carbohydrazide

CAS: 50371-65-8

4,5-Dibromo-1H-pyrrole-2-carbohydrazide

Purity: ≥95%

Molecular weight: 282.92g/mol

Ref: 54-OR15436