CAS 50372-61-7
:(4,5-Dibromo-1H-pyrrol-2-yl)phenylmethanone
Description:
(4,5-Dibromo-1H-pyrrol-2-yl)phenylmethanone, with the CAS number 50372-61-7, is an organic compound characterized by its unique structure that includes a pyrrole ring substituted with bromine atoms and a phenylmethanone moiety. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry due to the presence of both the bromine substituents and the carbonyl group. The bromine atoms can enhance the compound's reactivity and influence its electronic properties, making it useful in various chemical reactions, including electrophilic substitutions. Additionally, the pyrrole ring contributes to the compound's aromaticity and stability. Its solubility may vary depending on the solvent, but it is generally more soluble in organic solvents than in water. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, (4,5-Dibromo-1H-pyrrol-2-yl)phenylmethanone is a noteworthy compound in the realm of synthetic organic chemistry.
Formula:C11H7Br2NO
InChI:InChI=1S/C11H7Br2NO/c12-8-6-9(14-11(8)13)10(15)7-4-2-1-3-5-7/h1-6,14H
InChI key:InChIKey=ZTJSJDHXCJVYCI-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Br)=C(Br)N1)C2=CC=CC=C2
Synonyms:- (4,5-Dibromo-1H-pyrrol-2-yl)(phenyl)methanone
- (4,5-Dibromo-1H-pyrrol-2-yl)phenylmethanone
- 2,3-Dibromo-5-benzoylpyrrole
- 4,5-Dibromo-2-benzoylpyrrole
- Methanone, (4,5-dibromo-1H-pyrrol-2-yl)phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4,5-Dibromo-2-benzoylpyrrole
CAS:Controlled Product<p>Applications 4,5-Dibromo-2-benzoylpyrrole is used in preparation of 2,3-Dibromo-5-benzoyl Pyrrole via amidation of morpholine with Benzoyl Chloride, followed by Friedel-Crafts reaction with pyrrole and substitution with Br2.<br>References Yang, Q., et al.: Faming Zhuanli Shenqing, (2012);<br></p>Formula:C11H7Br2NOColor and Shape:NeatMolecular weight:328.987


