CAS 50376-99-3

3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione

Description:

3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione, with the CAS number 50376-99-3, is a chemical compound characterized by its unique structure, which includes a cyclobutene ring and two hydrazine substituents. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of the methylhydrazino groups suggests that it may exhibit biological activity, possibly as a result of its ability to form hydrazone derivatives or participate in redox reactions. The compound's cyclic structure may impart specific steric and electronic properties, influencing its stability and reactivity. Additionally, the hydrazine moieties can engage in various chemical reactions, including condensation and oxidation, making this compound of interest in medicinal chemistry and materials science. Overall, 3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione represents a versatile scaffold for further chemical exploration and potential applications.

Formula: C₆H₁₀N₄O₂

InChI: InChI=1/C6H10N4O2/c1-9(7)3-4(10(2)8)6(12)5(3)11/h7-8H2,1-2H3

SMILES: CN(C1=C(C(=O)C1=O)N(C)N)N

Synonyms:

• 3,4-Bis(1-Methylhydrazino)Cyclobut-3-Ene-1,2-Dione

3,4-Bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione

CAS: 50376-99-3

3,4-Bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione

Purity: 95%

Molecular weight: 170.17g/mol

Ref: 54-OR3361