CAS 5038-59-5

4-(bromoacetyl)benzenesulfonyl chloride

Description:

4-(Bromoacetyl)benzenesulfonyl chloride, with the CAS number 5038-59-5, is an organic compound characterized by its sulfonyl chloride functional group and a bromoacetyl substituent on a benzene ring. This compound typically appears as a solid or crystalline substance and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. It is often utilized in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. The bromoacetyl group enhances its electrophilic character, making it useful in coupling reactions and as an acylating agent. Additionally, this compound is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Safety precautions are essential when working with this substance due to its potential irritant properties and the need for proper storage conditions to maintain its stability.

Formula: C₈H₆BrClO₃S

InChI: InChI=1/C8H6BrClO3S/c9-5-8(11)6-1-3-7(4-2-6)14(10,12)13/h1-4H,5H2

SMILES: c1cc(ccc1C(=O)CBr)S(=O)(=O)Cl

Synonyms:

• Benzenesulfonyl chloride, 4-(2-bromoacetyl)-
• 4-(Bromoacetyl)benzenesulfonyl chloride

4-(2-Bromoacetyl)benzene-1-sulfonyl chloride

CAS: 5038-59-5

Formula: C₈H₆BrClO₃S

Purity: 96%

Molecular weight: 297.5534

Ref: IN-DA006U6D

4-(2-Bromoacetyl)benzene-1-sulfonyl chloride

CAS: 5038-59-5

4-(2-Bromoacetyl)benzene-1-sulfonyl chloride

Purity: 96%

Molecular weight: 297.56g/mol

Ref: 54-OR1065464

4-(2-Bromoacetyl)benzenesulfonyl chloride

CAS: 5038-59-5

Formula: C₈H₆BrClO₃S

Purity: 96%

Color and Shape: Solid

Molecular weight: 297.55

Ref: 10-F015076