CAS 503834-19-3
:[3-ethoxy-4-(methoxycarbonyl)phenyl]acetic acid
Description:
[3-Ethoxy-4-(methoxycarbonyl)phenyl]acetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both an ethoxy group and a methoxycarbonyl group. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the ethoxy group enhances its solubility in organic solvents, while the methoxycarbonyl group introduces a carbonyl functionality that can participate in various chemical reactions, such as esterification or amidation. The compound's structure suggests it may exhibit interesting biological activities, making it a candidate for pharmaceutical applications. Additionally, its molecular configuration allows for potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, [3-ethoxy-4-(methoxycarbonyl)phenyl]acetic acid is a versatile compound with properties that may be useful in synthetic organic chemistry and drug development.
Formula:C12H14O5
InChI:InChI=1/C12H14O5/c1-3-17-10-6-8(7-11(13)14)4-5-9(10)12(15)16-2/h4-6H,3,7H2,1-2H3,(H,13,14)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
