CAS 50392-39-7

4-Amino-2,5-dichlorophenol

Description:

4-Amino-2,5-dichlorophenol is an organic compound characterized by the presence of an amino group and two chlorine atoms attached to a phenolic ring. Its molecular structure features a phenol group with the amino group positioned at the para position relative to one of the chlorine substituents, and the other chlorine at the meta position. This compound is typically a solid at room temperature and is known for its potential applications in dye manufacturing, pharmaceuticals, and as a reagent in various chemical reactions. It exhibits properties such as moderate solubility in water and organic solvents, depending on the pH of the solution. The presence of both amino and chloro groups contributes to its reactivity, making it a useful intermediate in organic synthesis. However, safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.

Formula: C₆H₅Cl₂NO

InChI: InChI=1/C6H5Cl2NO/c7-3-2-6(10)4(8)1-5(3)9/h1-2,10H,9H2

SMILES: c1c(c(cc(c1N)Cl)O)Cl

Synonyms:

• 2,5-Dichloro-4-aminophenol

Phenol, 4-​amino-​2,​5-​dichloro-

CAS: 50392-39-7

Formula: C₆H₅Cl₂NO

Purity: 96%

Color and Shape: Solid

Molecular weight: 178.0160

Ref: IN-DA00I91T

4-Amino-2,5-dichlorophenol

CAS: 50392-39-7

4-Amino-2,5-dichlorophenol

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.02g/mol

Ref: 54-OR47853

2,5-Dichloro-4-aminophenol

CAS: 50392-39-7

Formula: C₆H₅Cl₂NO

Purity: 96%

Color and Shape: Solid, Brown powder

Molecular weight: 178.01

Ref: 10-F077937