CAS 50392-78-4

1-(4-Pyridyl)ethylamine

Description:

1-(4-Pyridyl)ethylamine, with the CAS number 50392-78-4, is an organic compound characterized by the presence of a pyridine ring and an ethylamine group. It features a pyridine nitrogen atom that contributes to its basicity and potential for hydrogen bonding, making it a polar molecule. The compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and various organic solvents, which enhances its utility in chemical reactions and applications. The presence of the pyridine moiety imparts unique reactivity, allowing it to participate in various chemical transformations, including nucleophilic substitutions and coordination with metal ions. Additionally, 1-(4-Pyridyl)ethylamine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted, as it may pose health risks if not handled properly. Overall, this compound serves as a valuable building block in organic synthesis and research.

Formula: C₇H₁₁N₂

InChI: InChI=1/C7H10N2/c1-6(8)7-2-4-9-5-3-7/h2-6H,8H2,1H3/p+1/t6-/m1/s1

Synonyms:

• 4-(1-Aminoethyl)pyridine

1-(4-Pyridyl)ethylamine, 97%

CAS: 50392-78-4

1-(4-Pyridyl)ethylamine is used as a pharmaceutical intermediates This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referen

Formula: C₇H₁₁N₂

Purity: 97%

Color and Shape: Colorless to yellow to orange, Viscous liquid or liquid

Molecular weight: 123.18

Ref: 02-H50303

1-(Pyridin-4-yl)ethanamine

CAS: 50392-78-4

Formula: C₇H₁₀N₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 122.1677

Ref: IN-DA003D11

4-(1-Aminoethyl)pyridine

CAS: 50392-78-4

4-(1-Aminoethyl)pyridine

Formula: C₇H₁₀N₂

Purity: 99%

Color and Shape: clear. pale yellow liquid

Molecular weight: 122.17g/mol

Ref: 54-OR01563

1-Pyridin-4-yl-ethylamine acid

CAS: 50392-78-4

Formula: C₇H₁₀N₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 122.171

Ref: 10-F030534