CAS 50397-74-5
:4-Amino-3-bromobenzonitrile
Description:
4-Amino-3-bromobenzonitrile, with the CAS number 50397-74-5, is an organic compound characterized by the presence of an amino group (-NH2), a bromine atom, and a nitrile group (-C≡N) attached to a benzene ring. This compound typically appears as a solid and is soluble in polar organic solvents. The amino group contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions. The bromine atom serves as a good leaving group, making it useful in synthetic organic chemistry. Additionally, the nitrile group is known for its ability to participate in various reactions, including hydrolysis and reduction. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, 4-Amino-3-bromobenzonitrile is a versatile compound with applications in both synthetic chemistry and potential medicinal chemistry.
Formula:C7H5BrN2
InChI:InChI=1/C7H5BrN2/c8-6-3-5(4-9)1-2-7(6)10/h1-3H,10H2
SMILES:c1cc(c(cc1C#N)Br)N
Synonyms:- Benzonitrile, 4-amino-3-bromo-
- 3-Bromo-4-Aminobenzonitrile
- 2-BROMO-4-CYANOANILINE
- 4-AMINO-3-BROMOBENZONITRILE
- 4-Amino-3-bromobenzonitrile, GC 97%
- 4-Amino-3-brombenzonitrile
- BUTTPARK 35\03-64
- 4-AMINO-3-BROMOBENZONITRILE 97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Amino-3-bromobenzonitrile
CAS:Formula:C7H5BrN2Purity:>98.0%(GC)(N)Color and Shape:White - Yellow Solid FormMolecular weight:197.044-Amino-3-bromobenzonitrile, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrN2Purity:97%Color and Shape:Pale cream, PowderMolecular weight:197.044-AMino-3-broMobenzonitrile
CAS:Formula:C7H5BrN2Purity:97%Color and Shape:SolidMolecular weight:197.03204-Amino-3-bromobenzonitrile
CAS:4-Amino-3-bromobenzonitrileFormula:C7H5BrN2Purity:≥95%Color and Shape: faint brown to beige crystalline powderMolecular weight:197.03g/mol4-Amino-3-bromobenzonitrile
CAS:4-Amino-3-bromobenzonitrile is a chemical compound that is synthesized by the reaction of 4-amino-2-bromobenzonitrile and NaBH4. It can be used as a ligand for copper, nickel, and cobalt ions. The crystalline form of 4-amino-3-bromobenzonitrile has been studied using x-ray diffraction and ultraviolet irradiation. The absorption spectra of the compound are in agreement with its nature as an azobenzene derivative.
Formula:C7H5BrN2Purity:Min. 95%Color and Shape:PowderMolecular weight:197.03 g/mol4-Amino-3-bromobenzonitrile
CAS:Formula:C7H5BrN2Purity:97%Color and Shape:SolidMolecular weight:197.035





