CAS 504-20-1
:Phorone
Description:
Phorone, with the CAS number 504-20-1, is an organic compound classified as a diketone, specifically a derivative of 2,4-pentadione. It is characterized by its yellowish color and has a distinctive sweet, floral odor. Phorone is known for its ability to undergo various chemical reactions, including polymerization and oxidation, making it of interest in organic synthesis and materials science. Its molecular structure features a conjugated system, which contributes to its reactivity and potential applications in the production of dyes and fragrances. Phorone is soluble in organic solvents but has limited solubility in water. Due to its chemical properties, it is important to handle phorone with care, as it may pose health risks upon exposure. Overall, phorone serves as a valuable compound in both industrial and research settings, highlighting the diverse applications of diketones in chemistry.
Formula:C9H14O
InChI:InChI=1S/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3
InChI key:InChIKey=MTZWHHIREPJPTG-UHFFFAOYSA-N
SMILES:C(C(C=C(C)C)=O)=C(C)C
Synonyms:- 2,5-Heptadien-4-one, 2,6-dimethyl-
- 2,6-Dimethyl-2,5-heptadien-4-one
- 2,6-Dimethylhepta-2,5-Dien-4-One
- Diisobutenyl ketone
- Diisopropylidene acetone
- Diisopropyllideneacetone
- Foron
- NSC 38718
- NSC 403517
- sym-Diisopropylidene acetone
- Phorone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,6-Dimethyl-2,5-heptadien-4-one
CAS:Formula:C9H14OPurity:95%Color and Shape:SolidMolecular weight:138.20692,6-Dimethyl-2,5-heptadien-4-one
CAS:2,6-Dimethyl-2,5-heptadien-4-one is an unsaturated ketone widely used in biochemical experiments and drug synthesis research.Formula:C9H14OPurity:99.90%Color and Shape:SolidMolecular weight:138.212,6-Dimethyl-2,5-heptadien-4-one
CAS:2,6-Dimethyl-2,5-heptadien-4-oneFormula:C9H14OPurity:98%Color and Shape: yellow low melting solidMolecular weight:138.21g/molDiisopropylidene Acetone
CAS:Controlled ProductFormula:C9H14OColor and Shape:NeatMolecular weight:138.212,6-Dimethyl-2,5-heptadien-4-one
CAS:Formula:C9H14OPurity:95%Color and Shape:LiquidMolecular weight:138.212,6-Dimethyl-2,5-heptadien-4-one
CAS:2,6-Dimethyl-2,5-heptadien-4-one is an organic compound that belongs to a class of compounds called reactive oxygen species (ROS). It is produced by the oxidation of 2,6-dimethyl-2,5-heptadienoic acid. ROS are formed in the mitochondria and have been shown to be involved in many cellular processes including mitochondrial function. ROS can induce oxidative stress leading to cell death. This compound has been shown to enhance the antibacterial efficacy of other antibiotics such as gentamycin and vancomycin. The mechanism of action is not fully understood but appears to involve intracellular glutathione depletion and damage to mitochondrial membrane potential.Formula:C9H14OPurity:Min. 95%Color and Shape:Yellow Clear LiquidMolecular weight:138.21 g/mol






