CymitQuimica logo

CAS 504-44-9

:

Crocetane

Description:
Crocetane, with the CAS number 504-44-9, is a hydrocarbon belonging to the class of alkanes. It is a straight-chain saturated hydrocarbon, specifically a C20 alkane, which means it consists of 20 carbon atoms and is fully saturated with hydrogen atoms. Crocetane is typically found in a colorless, odorless liquid form at room temperature. Its molecular structure contributes to its relatively high boiling point and low volatility compared to shorter-chain hydrocarbons. Crocetane is primarily of interest in research and industrial applications, particularly in the fields of organic chemistry and petrochemical studies. It is often used as a reference compound in various analytical techniques due to its well-defined properties. Additionally, like other long-chain alkanes, crocetane is insoluble in water but soluble in organic solvents, making it useful in various chemical processes. Safety data indicates that, while it may pose minimal health risks under normal handling conditions, appropriate safety measures should always be observed to mitigate any potential hazards.
Formula:C20H42
InChI:InChI=1S/C20H42/c1-17(2)11-9-15-19(5)13-7-8-14-20(6)16-10-12-18(3)4/h17-20H,7-16H2,1-6H3
InChI key:InChIKey=KKFZXXATNGJPJS-UHFFFAOYSA-N
SMILES:C(C(CCCCC(CCCC(C)C)C)C)CCC(C)C
Synonyms:
  • 2,6,11,15-Tetramethylhexadecane
  • Hexadecane, 2,6,11,15-tetramethyl-
  • Crocetane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.