CAS 504-53-0
:18-Pentatriacontanone
Description:
18-Pentatriacontanone, with the CAS number 504-53-0, is a long-chain ketone characterized by a carbon chain consisting of 35 carbon atoms and a ketone functional group (C=O) located at the 18th carbon position. This compound is part of the class of aliphatic ketones and is typically a colorless to pale yellow liquid at room temperature. It has a relatively high molecular weight and exhibits low volatility due to its long carbon chain, which contributes to its hydrophobic nature. The presence of the ketone functional group imparts specific reactivity, allowing it to participate in various chemical reactions, such as oxidation and reduction. 18-Pentatriacontanone is often used in organic synthesis and may serve as a precursor or intermediate in the production of other chemical compounds. Its physical properties, such as boiling point and solubility, are influenced by its long hydrocarbon chain, making it less soluble in water but more soluble in organic solvents. Overall, this compound is of interest in both industrial applications and research contexts.
Formula:C35H70O
InChI:InChI=1S/C35H70O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(36)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-34H2,1-2H3
InChI key:InChIKey=DMCJFWXGXUEHFD-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCCCCCCCCCCC)=O)CCCCCCCCCCCCCCCC
Synonyms:- 18-Pentatriacontanone
- Di-n-heptadecyl ketone
- Diheptadecyl ketone
- Ep 2036-18
- Heptadecyl ketone
- NSC 83612
- Stearone
- Wax KS
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
18-Pentatriacontanone
CAS:Formula:C35H70OPurity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:506.9418-Pentatriacontanone, tech. 85%
CAS:<p>Antiblocking agent</p>Formula:C35H70OPurity:85%Molecular weight:506.9418-Pentatriacontanone
CAS:<p>18-Pentatriacontanone is a dibenzopentacontane that has been used as an ingredient in detergent compositions. It exhibits antimicrobial activity and is effective against bacteria, fungi and viruses. 18-Pentatriacontanone is a light-emitting material, which can be synthesized by reacting with hydrochloric acid and methyl ethyl ketone in the presence of a film-forming polymer such as sodium carbonate. The light emission is due to the nitrogen atoms present in the molecule. The synthesis methods for 18-pentatriacontanone are varied, but it can be prepared by reacting an organic compound containing at least one fatty acid with an amine or ammonia gas. The reaction mechanism for this process involves chloromethylation of the substrate followed by elimination of chlorine from the product. This reaction proceeds via a free radical mechanism with particle formation.</p>Formula:C35H70OPurity:Min. 95%Color and Shape:PowderMolecular weight:506.94 g/mol







