CAS 50402-83-0
:(7-methyl-2-oxo-2H-chromen-4-yl)acetic acid
Description:
(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid, identified by its CAS number 50402-83-0, is a chemical compound that belongs to the class of coumarins, which are known for their aromatic properties and potential biological activities. This compound features a coumarin backbone with a methyl group and a carboxylic acid functional group, contributing to its reactivity and solubility in various solvents. The presence of the keto group enhances its potential for hydrogen bonding and reactivity in organic synthesis. Coumarins, including this compound, are often studied for their pharmacological properties, including anti-inflammatory, anticoagulant, and antimicrobial activities. The structural characteristics, such as the chromen-4-yl moiety, suggest that it may participate in π-π stacking interactions, which can influence its biological activity and interactions with other molecules. Overall, (7-methyl-2-oxo-2H-chromen-4-yl)acetic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structure and potential applications.
Formula:C12H10O4
InChI:InChI=1/C12H10O4/c1-7-2-3-9-8(5-11(13)14)6-12(15)16-10(9)4-7/h2-4,6H,5H2,1H3,(H,13,14)
SMILES:Cc1ccc2c(CC(=O)O)cc(=O)oc2c1
Synonyms:- 2H-1-benzopyran-4-acetic acid, 7-methyl-2-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(7-methyl-2-oxo-2H-chromen-4-yl)acetic acid
CAS:Formula:C12H10O4Purity:95%Color and Shape:SolidMolecular weight:218.20542-(7-Methyl-2-Oxo-2H-Chromen-4-Yl)Acetic Acid
CAS:2-(7-Methyl-2-Oxo-2H-Chromen-4-Yl)Acetic AcidPurity:95%Molecular weight:218.21g/mol2-(7-methyl-2-oxo-2H-chromen-4-yl)acetic Acid
CAS:Controlled ProductApplications 2-(7-methyl-2-oxo-2H-chromen-4-yl)acetic Acid (cas# 50402-83-0) is a useful research chemical.
Formula:C12H10O4Color and Shape:NeatMolecular weight:218.2(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid
CAS:(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid is a coumarin derivative that is used as a fluorescent probe to study the interaction of electron donors and acceptors. This compound has been shown to have photophysical properties, such as fluorescence and photoinduced electron transfer, which can be modulated by the presence of electron donors, such as piperidine or styryl. (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid belongs to the group of ethylenic compounds with moieties that are similar to those found in coumarin and phenothiazine.Formula:C12H10O4Purity:Min. 95%Molecular weight:218.21 g/mol




