CAS 5041-67-8: Juglanin
Description:Juglanin, with the CAS number 5041-67-8, is a natural compound primarily found in the leaves and bark of walnut trees, particularly in the genus Juglans. It is classified as a flavonoid glycoside, which means it consists of a flavonoid moiety linked to a sugar molecule. Juglanin exhibits various biological activities, including antioxidant, anti-inflammatory, and potential antimicrobial properties, making it of interest in pharmacological research. The compound is known for its ability to scavenge free radicals, which contributes to its protective effects against oxidative stress. Additionally, juglanin may play a role in plant defense mechanisms, helping to protect the walnut tree from pests and diseases. Its solubility characteristics can vary, often being more soluble in polar solvents. Research into juglanin continues to explore its potential health benefits and applications in natural product chemistry and herbal medicine. Overall, juglanin represents a significant compound within the realm of phytochemicals, highlighting the importance of plant-derived substances in both traditional and modern medicine.
Formula:C20H18O10
InChI:InChI=1S/C20H18O10/c21-7-13-15(25)17(27)20(29-13)30-19-16(26)14-11(24)5-10(23)6-12(14)28-18(19)8-1-3-9(22)4-2-8/h1-6,13,15,17,20-25,27H,7H2/t13-,15-,17+,20-/m0/s1
InChI key:InChIKey=POQICXMTUPVZMX-UXYNSRGZSA-N
SMILES:O=C1C(OC2OC(CO)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=CC(O)=CC4
- Synonyms:
- Juglanin
- 4H-1-Benzopyran-4-one, 3-(α-L-arabinofuranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-
- Flavone, 3,4′,5,7-tetrahydroxy-, 3-α-L-arabinofuranoside
- Arabinofuranoside, kaempferol-3, α-L-
- Arabinofuranoside, 5,7-dihydroxy-2-(p-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl, α-L-
