CAS 50413-30-4
:Methyl 2-amino-4-methoxybenzoate
Description:
Methyl 2-amino-4-methoxybenzoate, with the CAS number 50413-30-4, is an organic compound that belongs to the class of benzoate esters. It features a methoxy group (-OCH3) and an amino group (-NH2) attached to a benzene ring, which contributes to its chemical reactivity and potential applications. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the amino group allows for hydrogen bonding, which can influence its solubility and interaction with other molecules. Methyl 2-amino-4-methoxybenzoate may be utilized in various chemical syntheses, including the production of pharmaceuticals and agrochemicals, due to its functional groups that can participate in further chemical reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions should be observed, as it may pose health risks if ingested or inhaled.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-12-6-3-4-7(8(10)5-6)9(11)13-2/h3-5H,10H2,1-2H3
SMILES:COc1ccc(c(c1)N)C(=O)OC
Synonyms:- Benzoic Acid, 2-Amino-4-Methoxy-, Methyl Ester
- Methyl-2-amino-4-methoxybenzolcarboxylat
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-amino-4-methoxylbenzoate
CAS:Formula:C9H11NO3Purity:97%Color and Shape:SolidMolecular weight:181.1885Methyl 2-amino-4-methoxybenzoate
CAS:Methyl 2-amino-4-methoxybenzoatePurity:98%Molecular weight:181.19g/mol2-Amino-4-methoxy-benzoic acid methyl ester
CAS:2-Amino-4-methoxy-benzoic acid methyl ester is a high quality, versatile building block for the synthesis of complex compounds. It is an intermediate in the synthesis of a number of biologically active compounds and has been used as a reagent for the determination of amino acids. 2-Amino-4-methoxy-benzoic acid methyl ester is soluble in water and polar organic solvents.Formula:C9H11NO3Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:181.19 g/molMethyl 2-amino-4-methoxylbenzoate
CAS:Formula:C9H11NO3Purity:95%Color and Shape:SolidMolecular weight:181.191




