CAS 5042-03-5

1,5,6-Trihydroxyxanthone

Description:

1,5,6-Trihydroxyxanthone is a chemical compound belonging to the xanthone family, characterized by its three hydroxyl (-OH) groups located at the 1, 5, and 6 positions of the xanthone structure. This compound exhibits a yellow to orange color, typical of xanthones, and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The presence of multiple hydroxyl groups enhances its reactivity and solubility in polar solvents, making it of interest in various fields, including pharmaceuticals and natural product chemistry. 1,5,6-Trihydroxyxanthone can be derived from natural sources, particularly from certain plant species, and may also be synthesized in the laboratory. Its molecular structure contributes to its ability to interact with various biological targets, which is a focus of research in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors, such as pH and temperature, which are important considerations in its application and study.

Formula: C₁₃H₈O₅

InChI: InChI=1S/C13H8O5/c14-7-2-1-3-9-10(7)11(16)6-4-5-8(15)12(17)13(6)18-9/h1-5,14-15,17H

InChI key: InChIKey=QVQLOWQNIFSVLU-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=3C1=C(O)C=CC3)=C(O)C(O)=CC2

Synonyms:

• 1,5,6-Trihydroxyxanthone
• 9H-xanthen-9-one, 1,5,6-trihydroxy-
• Mesuaxanthone B
• Xanthen-9-one, 1,5,6-trihydroxy-
• 1,5,6-Trihydroxy-9H-xanthen-9-one

1,5,6-Trihydroxyxanthone

CAS: 5042-03-5

1,5,6-Trihydroxyxanthone exhibits antibacterial activity against Gram-positive bacteria.

Formula: C₁₃H₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 244.202

Ref: TM-TN2502

1,5,6-Trihydroxyxanthone

CAS: 5042-03-5

1,5,6-Trihydroxyxanthone is a natural xanthone derivative, which is commonly isolated from various plant sources, particularly in the family Gentianaceae. This compound is characterized by its polyhydroxylated xanthone structure, contributing to its diverse biological functionalities. Xanthones, including 1,5,6-Trihydroxyxanthone, are known for their ability to modulate oxidative pathways and interact with cellular signaling mechanisms.

Formula: C₁₃H₈O₅

Purity: Min. 95%

Molecular weight: 244.2 g/mol

Ref: 3D-FT106516