CAS 5043-05-0

2-Naphthalenecarboxylic acid, 6-(dimethylamino)-

Description:

2-Naphthalenecarboxylic acid, 6-(dimethylamino)-, also known by its CAS number 5043-05-0, is an organic compound characterized by its naphthalene structure with a carboxylic acid group and a dimethylamino substituent. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The dimethylamino group enhances its basicity and can influence its reactivity and interaction with other molecules, making it useful in various applications, including as a dye intermediate or in organic synthesis. Additionally, the compound may exhibit fluorescence properties due to its aromatic structure, which can be leveraged in analytical chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1S/C13H13NO2/c1-14(2)12-6-5-9-7-11(13(15)16)4-3-10(9)8-12/h3-8H,1-2H3,(H,15,16)

InChI key: InChIKey=OAPBBTYSMWBVPM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(C=C(N(C)C)C=C2)C=C1

6-(Dimethylamino)-2-naphthoic acid

CAS: 5043-05-0

Formula: C₁₃H₁₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.2478

Ref: IN-DA006TTW

6-(Dimethylamino)-2-naphthoic acid

CAS: 5043-05-0

6-(Dimethylamino)-2-naphthoic acid

Purity: 97%

Molecular weight: 215.25g/mol

Ref: 54-OR77914

6-(Dimethylamino)-2-naphthoic acid

CAS: 5043-05-0

Purity: 98%

Molecular weight: 215.2519989

Ref: 10-F689565

6-(dimethylamino)naphthalene-2-carboxylic Acid

Controlled Product

CAS: 5043-05-0

Stability Hygroscopic
Applications 6-(dimethylamino)naphthalene-2-carboxylic Acid (cas# 5043-05-0) is a useful research chemical.

Formula: C₁₃H₁₃NO₂

Color and Shape: Neat

Molecular weight: 215.25

Ref: TR-B402658

6-(Dimethylamino)-2-naphthoic acid

CAS: 5043-05-0

6-(Dimethylamino)-2-naphthoic acid is a hydrophobic molecule that interacts with the cellular membrane. It has been shown to be an effective probe for studying the interactions of hydrophobic compounds with the lipid bilayer of cells. 6-(Dimethylamino)-2-naphthoic acid can be used as a fluorescent probe to measure levels of membrane phospholipids in cells. The fluorescence intensity is proportional to the number of molecules bound, and can be monitored by measuring changes in wavelength or lifetime. 6-(Dimethylamino)-2-naphthoic acid binds to nucleosides and thus has been used as a fluorescent probe for studying biological processes such as DNA replication, transcription, and translation.

Formula: C₁₃H₁₃NO₂

Purity: Min. 95%

Molecular weight: 215.25 g/mol

Ref: 3D-FAA04305