CAS 50432-01-4

4-amino-2,6-diphenylphenol

Description:

4-Amino-2,6-diphenylphenol, with the CAS number 50432-01-4, is an organic compound characterized by the presence of an amino group and two phenyl groups attached to a phenolic structure. This compound typically exhibits a solid form at room temperature and is known for its potential applications in various fields, including dye chemistry and as an intermediate in organic synthesis. The presence of the amino group contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, such as electrophilic substitutions. Additionally, the diphenyl substitution enhances its stability and may influence its solubility in organic solvents. The compound may also exhibit specific optical properties, making it of interest in materials science. Safety data should be consulted, as with any chemical, to understand its handling, toxicity, and environmental impact. Overall, 4-amino-2,6-diphenylphenol is a versatile compound with significant implications in both industrial and research applications.

Formula: C₁₈H₁₅NO

InChI: InChI=1/C18H15NO/c19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14/h1-12,20H,19H2

SMILES: c1ccc(cc1)c1cc(cc(c2ccccc2)c1O)N

Synonyms:

• Aminodiphenylphenol
• 5'-Amino-1,1':3',1''-Terphenyl-2'-Ol

5'-Amino-[1,1':3',1''-terphenyl]-2'-ol

CAS: 50432-01-4

Formula: C₁₈H₁₅NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 261.3178

Ref: IN-DA003MC1

5'-Amino-[1,1':3',1''-Terphenyl]-2'-Ol

CAS: 50432-01-4

5'-Amino-[1,1':3',1''-Terphenyl]-2'-Ol

Purity: 98%

Molecular weight: 261.32g/mol

Ref: 54-OR1027256

4-Amino-2,6-diphenylphenol

CAS: 50432-01-4

Formula: C₁₈H₁₅NO

Purity: >98.0%(GC)(T)

Color and Shape: White to Brown to Dark purple powder to crystal

Molecular weight: 261.32

Ref: 3B-A1269

5'-Amino-[1,1':3',1''-terphenyl]-2'-ol

CAS: 50432-01-4

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 261.3240051269531

Ref: 10-F222834